| Product Name | 3-Chloro-4-fluorobenzylamine |
| CAS No. | 72235-56-4 |
| Synonyms | 1-(3-chloro-4-fluorophenyl)methanamine; 1-{4-[(4-fluorobenzyl)oxy]phenyl}ethanone; 3-Chloro-4-fluorobenzyl amine |
| InChI | InChI=1/C15H13FO2/c1-11(17)13-4-8-15(9-5-13)18-10-12-2-6-14(16)7-3-12/h2-9H,10H2,1H3 |
| Molecular Formula | C15H13FO2 |
| Molecular Weight | 244.2609 |
| Density | 1.163g/cm3 |
| Boiling point | 382.9°C at 760 mmHg |
| Flash point | 179°C |
| Refractive index | 1.555 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
72235-56-4 3-chloro-4-fluorobenzylamine
service@apichina.com