| Product Name | 3-Chloro-2-fluorobenzylamine |
| CAS No. | 72235-55-3 |
| Synonyms | 1-(3-chloro-2-fluorophenyl)methanamine |
| InChI | InChI=1/C7H7ClFN/c8-6-3-1-2-5(4-10)7(6)9/h1-3H,4,10H2 |
| Molecular Formula | C7H7ClFN |
| Molecular Weight | 159.5886 |
| Density | 1.27g/cm3 |
| Boiling point | 219.6°C at 760 mmHg |
| Flash point | 86.6°C |
| Refractive index | 1.543 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
72235-55-3 3-chloro-2-fluorobenzylamine
service@apichina.com