| Product Name | 3,5-Diacetoxy Benzoic Acid |
| CAS No. | 35354-29-1 |
| Synonyms | 3,5-Diacetoxybenzoic acid; 3,5-bis(acetyloxy)benzoic acid |
| InChI | InChI=1/C11H10O6/c1-6(12)16-9-3-8(11(14)15)4-10(5-9)17-7(2)13/h3-5H,1-2H3,(H,14,15) |
| Molecular Formula | C11H10O6 |
| Molecular Weight | 238.1935 |
| Density | 1.344g/cm3 |
| Boiling point | 408.4°C at 760 mmHg |
| Flash point | 160.4°C |
| Refractive index | 1.543 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
35354-29-1 3,5-diacetoxy benzoic acid
service@apichina.com