| Product Name | 1-Bromo-5-methylhexane |
| CAS No. | 35354-37-1 |
| InChI | InChI=1/C7H15Br/c1-7(2)5-3-4-6-8/h7H,3-6H2,1-2H3 |
| Molecular Formula | C7H15Br |
| Molecular Weight | 179.098 |
| Density | 1.136g/cm3 |
| Boiling point | 168°C at 760 mmHg |
| Flash point | 48.4°C |
| Refractive index | 1.447 |
| Risk Codes | R10:Flammable.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
35354-37-1 1-bromo-5-methylhexane
service@apichina.com