| Sales Email | Service@apichina.com |
| CAS No. | 368869-96-9 |
| Product Name | 3-(4-bromophenoxy)-6-methylpyridazine |
| Synonyms | Ethyl 4-bromo-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| InChI | InChI=1/C11H9BrN2O/c1-8-2-7-11(14-13-8)15-10-5-3-9(12)4-6-10/h2-7H,1H3 |
| Molecular Formula | C11H9BrN2O |
| Molecular Weight | 265.106 |
| Density | 1.481g/cm3 |
| Melting point | 145℃ |
| Boiling point | 387.6°C at 760 mmHg |
| Flash point | 188.2°C |
| Refractive index | 1.602 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
