| Sales Email | Service@apichina.com |
| CAS No. | 368869-95-8 |
| Product Name | 3-(1H-pyrrol-1-yl)benzylamine |
| Synonyms | 1-[3-(1H-pyrrol-1-yl)phenyl]methanamine |
| InChI | InChI=1/C11H12N2/c12-9-10-4-3-5-11(8-10)13-6-1-2-7-13/h1-8H,9,12H2 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.2264 |
| Density | 1.07g/cm3 |
| Boiling point | 317.7°C at 760 mmHg |
| Flash point | 145.9°C |
| Refractive index | 1.589 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
