| Product Name | (2E)-2,6-bis(4-fluorophenyl)-4-methyl-5-phenylhept-2-enedinitrile |
| CAS No. | 128350-04-9 |
| InChI | InChI=1/C26H20F2N2/c1-18(15-22(16-29)19-7-11-23(27)12-8-19)26(21-5-3-2-4-6-21)25(17-30)20-9-13-24(28)14-10-20/h2-15,18,25-26H,1H3/b22-15- |
| Molecular Formula | C26H20F2N2 |
| Molecular Weight | 398.4472 |
| Density | 1.19g/cm3 |
| Boiling point | 584°C at 760 mmHg |
| Flash point | 307°C |
| Refractive index | 1.588 |
128350-04-9 (2e)-2,6-bis(4-fluorophenyl)-4-methyl-5-phenylhept-2-enedinitrile
service@apichina.com