| Product Name | (2E)-2,6-bis(3,4-dichlorophenyl)-4-methyl-5-phenylhept-2-enedinitrile |
| CAS No. | 128350-00-5 |
| InChI | InChI=1/C26H18Cl4N2/c1-16(11-20(14-31)18-7-9-22(27)24(29)12-18)26(17-5-3-2-4-6-17)21(15-32)19-8-10-23(28)25(30)13-19/h2-13,16,21,26H,1H3/b20-11- |
| Molecular Formula | C26H18Cl4N2 |
| Molecular Weight | 500.2465 |
| Density | 1.337g/cm3 |
| Boiling point | 671°C at 760 mmHg |
| Flash point | 263.7°C |
| Refractive index | 1.625 |
128350-00-5 (2e)-2,6-bis(3,4-dichlorophenyl)-4-methyl-5-phenylhept-2-enedinitrile
service@apichina.com