| Product Name | 2-bromo-4-hydroxymethylpyridine |
| CAS No. | 118289-16-0 |
| Synonyms | 2-Bromo-4-(hydroxymethyl)pyridine; 2-Bromopyridine-4-methanol; (2-bromopyridin-4-yl)methanol |
| InChI | InChI=1/C6H6BrNO/c7-6-3-5(4-9)1-2-8-6/h1-3,9H,4H2 |
| Molecular Formula | C6H6BrNO |
| Molecular Weight | 188.0219 |
| Density | 1.668g/cm3 |
| Boiling point | 316.6°C at 760 mmHg |
| Flash point | 145.3°C |
| Refractive index | 1.598 |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
118289-16-0 2-bromo-4-hydroxymethylpyridine
service@apichina.com