| Product Name | 2-Bromopyridine-4-carboxaldehyde |
| CAS No. | 118289-17-1 |
| Synonyms | 2-Bromoisonicotinaldehyde; 2-Bromo-4-pyridinecarboxaldehyde; 2-bromopyridine-4-carbaldehyde |
| InChI | InChI=1/C6H4BrNO/c7-6-3-5(4-9)1-2-8-6/h1-4H |
| Molecular Formula | C6H4BrNO |
| Molecular Weight | 186.0061 |
| Density | 1.683g/cm3 |
| Boiling point | 272.878°C at 760 mmHg |
| Flash point | 118.832°C |
| Refractive index | 1.619 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
118289-17-1 2-bromopyridine-4-carboxaldehyde
service@apichina.com