| Product Name | 2,6-Dibromo-4-n-propylaniline |
| CAS No. | 10546-64-2 |
| Synonyms | 2,6-dibromo-4-propylaniline |
| InChI | InChI=1/C9H11Br2N/c1-2-3-6-4-7(10)9(12)8(11)5-6/h4-5H,2-3,12H2,1H3 |
| Molecular Formula | C9H11Br2N |
| Molecular Weight | 292.9983 |
| Density | 1.689g/cm3 |
| Boiling point | 316.9°C at 760 mmHg |
| Flash point | 145.5°C |
| Refractive index | 1.609 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S28:After contact with skin, wash immediately with plenty of ...; S36/37:Wear suitable protective clothing and gloves.; |
10546-64-2 2,6-dibromo-4-n-propylaniline
service@apichina.com