| Product Name | 2,6-Dibromo-4-isopropylaniline |
| CAS No. | 10546-65-3 |
| Synonyms | 2,6-Dibromo-4-n-propylaniline; 2,6-dibromo-4-(propan-2-yl)aniline; 2,6-dibromo-4-(1-methylethyl)-Benzenamine |
| InChI | InChI=1/C9H11Br2N/c1-5(2)6-3-7(10)9(12)8(11)4-6/h3-5H,12H2,1-2H3 |
| Molecular Formula | C9H11Br2N |
| Molecular Weight | 292.9983 |
| Density | 1.682g/cm3 |
| Boiling point | 310.6°C at 760 mmHg |
| Flash point | 141.6°C |
| Refractive index | 1.605 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
10546-65-3 2,6-dibromo-4-isopropylaniline
service@apichina.com