| Product Name | 2,4,5-trifluorobenzyl alcohol |
| CAS No. | 144284-25-3 |
| Synonyms | (2,4,5-trifluorophenyl)methanol |
| InChI | InChI=1/C6H3BrF2O/c7-3-1-2-4(10)6(9)5(3)8/h1-2,10H |
| Molecular Formula | C7H5F3O |
| Molecular Weight | 162.11 |
| Density | 1.858g/cm3 |
| Boiling point | 213.308°C at 760 mmHg |
| Flash point | 82.806°C |
| Refractive index | 1.55 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
144284-25-3 2,4,5-trifluorobenzyl alcohol
service@apichina.com