| Product Name | 2,3,4-trifluorobenzyl alcohol |
| CAS No. | 144284-24-2 |
| Synonyms | 1,2,3-trifluoro-4-methoxybenzene; (2,3,4-trifluorophenyl)methanol |
| InChI | InChI=1/C7H5F3O/c8-5-2-1-4(3-11)6(9)7(5)10/h1-2,11H,3H2 |
| Molecular Formula | C7H5F3O |
| Molecular Weight | 162.1092 |
| Density | 1.398g/cm3 |
| Boiling point | 195.5°C at 760 mmHg |
| Flash point | 84.5°C |
| Refractive index | 1.476 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
144284-24-2 2,3,4-trifluorobenzyl alcohol
service@apichina.com