| Sales Email | Service@apichina.com |
| CAS No. | 13078-14-3 |
| Product Name | 1-(4-Methylphenyl)piperazine dihydrochloride |
| Synonyms | 1-(p-Tolyl)piperazine dihydrochloride; N-(4-Methylphenyl)piperazine dihydrochloride |
| InChI | InChI=1/C11H16N2.2ClH/c1-10-2-4-11(5-3-10)13-8-6-12-7-9-13;;/h2-5,12H,6-9H2,1H3;2*1H |
| Molecular Formula | C11H18Cl2N2 |
| Molecular Weight | 249.18 |
| Melting point | 214℃ |
| Boiling point | 321.2°C at 760 mmHg |
| Flash point | 153.8°C |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
