| Sales Email | Service@apichina.com |
| CAS No. | 13078-13-2 |
| Product Name | 1-(3-Methylphenyl)piperazine dihydrochloride |
| Synonyms | 1-(m-Tolyl)piperazine dihydrochloride; 1-(m-Tolyl)piperazine hydrochloride; N-(3-Methylphenyl)piperazine dihydrochloride; 4-(3-methylphenyl)piperazin-1-ium |
| InChI | InChI=1/C11H16N2/c1-10-3-2-4-11(9-10)13-7-5-12-6-8-13/h2-4,9,12H,5-8H2,1H3/p+1 |
| Molecular Formula | C11H17N2 |
| Molecular Weight | 177.2655 |
| Melting point | 195-202℃ |
| Boiling point | 321.4°C at 760 mmHg |
| Flash point | 154°C |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
