| Sales Email | Service@apichina.com |
| CAS No. | 368869-86-7 |
| Product Name | 1-(4-iodophenyl)-1H-pyrazole |
| InChI | InChI=1/C9H7IN2/c10-8-2-4-9(5-3-8)12-7-1-6-11-12/h1-7H |
| Molecular Formula | C9H7IN2 |
| Molecular Weight | 270.0697 |
| Density | 1.75g/cm3 |
| Melting point | 88℃ |
| Boiling point | 304.3°C at 760 mmHg |
| Flash point | 137.8°C |
| Refractive index | 1.688 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
