| Sales Email | Service@apichina.com |
| CAS No. | 368869-85-6 |
| Product Name | 1-[4-(bromomethyl)phenyl]-1H-pyrazole |
| InChI | InChI=1/C10H9BrN2/c11-8-9-2-4-10(5-3-9)13-7-1-6-12-13/h1-7H,8H2 |
| Molecular Formula | C10H9BrN2 |
| Molecular Weight | 237.0959 |
| Density | 1.44g/cm3 |
| Melting point | 77℃ |
| Boiling point | 315.3°C at 760 mmHg |
| Flash point | 144.5°C |
| Refractive index | 1.623 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
