| Product Name | 1-(4-chlorophenyl)-5-propyl-1H-pyrazole-4-carboxylic acid |
| CAS No. | 175137-17-4 |
| InChI | InChI=1/C13H13ClN2O2/c1-2-3-12-11(13(17)18)8-15-16(12)10-6-4-9(14)5-7-10/h4-8H,2-3H2,1H3,(H,17,18) |
| Molecular Formula | C13H13ClN2O2 |
| Molecular Weight | 264.7075 |
| Density | 1.3g/cm3 |
| Melting point | 116℃ |
| Boiling point | 415°C at 760 mmHg |
| Flash point | 204.8°C |
| Refractive index | 1.609 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
175137-17-4 1-(4-chlorophenyl)-5-propyl-1h-pyrazole-4-carboxylic acid
service@apichina.com