| Product Name | 1-(4-chlorophenyl)-5-propyl-1H-pyrazole-4-carbonyl chloride |
| CAS No. | 175137-18-5 |
| InChI | InChI=1/C13H12Cl2N2O/c1-2-3-12-11(13(15)18)8-16-17(12)10-6-4-9(14)5-7-10/h4-8H,2-3H2,1H3 |
| Molecular Formula | C13H12Cl2N2O |
| Molecular Weight | 283.1532 |
| Density | 1.31g/cm3 |
| Boiling point | 398.7°C at 760 mmHg |
| Flash point | 194.9°C |
| Refractive index | 1.605 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
175137-18-5 1-(4-chlorophenyl)-5-propyl-1h-pyrazole-4-carbonyl chloride
service@apichina.com