| Sales Email | Service@apichina.com |
| CAS No. | 3512-17-2 |
| Product Name | 2,4,6-Trifluoropyridine |
| InChI | InChI=1/C5H2F3N/c6-3-1-4(7)9-5(8)2-3/h1-2H |
| Molecular Formula | C5H2F3N |
| Molecular Weight | 133.0713 |
| Density | 1.396g/cm3 |
| Boiling point | 121.9°C at 760 mmHg |
| Flash point | 27.5°C |
| Refractive index | 1.424 |
| Risk Codes | R11:Highly flammable.; R34:Causes burns.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
