| Product Name | 2,3,6-Trifluoropyridine |
| CAS No. | 3512-18-3 |
| InChI | InChI=1/C5H2F3N/c6-3-1-2-4(7)9-5(3)8/h1-2H |
| Molecular Formula | C5H2F3N |
| Molecular Weight | 133.0713 |
| Density | 1.396g/cm3 |
| Boiling point | 123.7°C at 760 mmHg |
| Flash point | 28.6°C |
| Refractive index | 1.424 |
| Risk Codes | R10:Flammable.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
3512-18-3 2,3,6-trifluoropyridine
service@apichina.com