| Product Name | Z-NHNH2 . HCl |
| CAS No. | 2540-62-7 |
| Synonyms | N-ALPHA-BENZYLOXYCARBONYLOXYHYDRAZINE HYDROCHLORIDE; benzyl hydrazinecarboxylate |
| InChI | InChI=1/C8H10N2O2/c9-10-8(11)12-6-7-4-2-1-3-5-7/h1-5H,6,9H2,(H,10,11) |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.1772 |
| Density | 1.202g/cm3 |
| Boiling point | 351.3°C at 760 mmHg |
| Flash point | 166.3°C |
| Refractive index | 1.56 |
2540-62-7 z-nhnh2 . hcl
service@apichina.com