| Product Name | Z-His(Bzl)-OH |
| CAS No. | 21929-66-8 |
| Synonyms | 1-benzyl-N-[(benzyloxy)carbonyl]histidine |
| InChI | InChI=1/C21H21N3O4/c25-20(26)19(23-21(27)28-14-17-9-5-2-6-10-17)11-18-13-24(15-22-18)12-16-7-3-1-4-8-16/h1-10,13,15,19H,11-12,14H2,(H,23,27)(H,25,26) |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.4091 |
| Density | 1.25g/cm3 |
| Boiling point | 649.3°C at 760 mmHg |
| Flash point | 346.5°C |
| Refractive index | 1.613 |
21929-66-8 z-his(bzl)-oh
service@apichina.com