| Product Name | Xanthene-9-carboxylic acid |
| CAS No. | 82-07-5 |
| Synonyms | xanthoic acid; Methyl xanthene-9-carboxylate; 9-Xanthene carboxylic acid; Xomthene-9-carboxylic methylester acid; 9H-xanthene-9-carboxylic acid; 9H-xanthene-9-carboxylate |
| InChI | InChI=1/C14H10O3/c15-14(16)13-9-5-1-3-7-11(9)17-12-8-4-2-6-10(12)13/h1-8,13H,(H,15,16)/p-1 |
| Molecular Formula | C14H9O3 |
| Molecular Weight | 225.22 |
| Melting point | 221-225℃ |
| Boiling point | 391.3°C at 760 mmHg |
| Flash point | 153.1°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
82-07-5 xanthene-9-carboxylic acid
service@apichina.com