| Product Name | Violuric acid monohydrate |
| CAS No. | 26351-19-9 |
| Synonyms | Alloxan-5-oxime monohydrate; 5-Isonitrosobarbituric acid monohydrate; 5-(hydroxyimino)pyrimidine-2,4,6(1H,3H,5H)-trione hydrate (1:1) |
| InChI | InChI=1/C4H3N3O4.H2O/c8-2-1(7-11)3(9)6-4(10)5-2;/h11H,(H2,5,6,8,9,10);1H2 |
| Molecular Formula | C4H5N3O5 |
| Molecular Weight | 175.0996 |
| Melting point | 236-240℃ |
| Boiling point | 449°C at 760 mmHg |
| Flash point | 225.4°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
26351-19-9 violuric acid monohydrate
service@apichina.com