| Product Name | Vanillic acid hydrazide |
| CAS No. | 100377-63-7 |
| Synonyms | 4-Hydroxy-3-methoxybenzhydrazide; 4-hydroxy-3-methoxybenzohydrazide |
| InChI | InChI=1/C8H10N2O3/c1-13-7-4-5(8(12)10-9)2-3-6(7)11/h2-4,11H,9H2,1H3,(H,10,12) |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.1766 |
| Density | 1.307g/cm3 |
| Refractive index | 1.594 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
100377-63-7 vanillic acid hydrazide
service@apichina.com