| Product Name | Valeric acid hydrazide |
| CAS No. | 38291-82-6 |
| Synonyms | Pentanoic acid hydrazide; pentanehydrazide |
| InChI | InChI=1/C5H12N2O/c1-2-3-4-5(8)7-6/h2-4,6H2,1H3,(H,7,8) |
| Molecular Formula | C5H12N2O |
| Molecular Weight | 116.1616 |
| Density | 0.962g/cm3 |
| Boiling point | 260.6°C at 760 mmHg |
| Flash point | 111.4°C |
| Refractive index | 1.449 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
38291-82-6 valeric acid hydrazide
service@apichina.com