| Product Name | Undecyl methacrylate |
| CAS No. | 16493-35-9 |
| Synonyms | 2-Propenoic acid, 2-methyl-, undecyl ester; undecyl 2-methylprop-2-enoate |
| InChI | InChI=1/C15H28O2/c1-4-5-6-7-8-9-10-11-12-13-17-15(16)14(2)3/h2,4-13H2,1,3H3 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.3816 |
| Density | 0.875g/cm3 |
| Boiling point | 305.9°C at 760 mmHg |
| Flash point | 124.4°C |
| Refractive index | 1.443 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S28:After contact with skin, wash immediately with plenty of ...; |
16493-35-9 undecyl methacrylate
service@apichina.com