| Product Name | tris[(E)-3,7-dimethylocta-2,6-dien-1-ol], triester with boric acid |
| CAS No. | 65416-33-3 |
| Synonyms | 2,6-Octadien-1-ol, 3,7-dimethyl-, 1,1',1''-triester with boric acid (H3BO3), (2E,2'E,2''E)-; 3,7-Dimethyl-2-trans-6-octadienol borate; 2,6-Octadien-1-ol, 3,7-dimethyl-, triester with boric acid (H3BO3), (2E,2'E,2''E)-; Tris((E)-3,7-dimethylocta-2,6-dien-1-ol), triester with boric acid; (2E)-3,7-dimethylocta-2,6-dien-1-yl bis[(2Z)-3,7-dimethylocta-2,6-dien-1-yl] borate |
| InChI | InChI=1/C30H51BO3/c1-25(2)13-10-16-28(7)19-22-32-31(33-23-20-29(8)17-11-14-26(3)4)34-24-21-30(9)18-12-15-27(5)6/h13-15,19-21H,10-12,16-18,22-24H2,1-9H3/b28-19-,29-20-,30-21+ |
| Molecular Formula | C30H51BO3 |
| Molecular Weight | 470.5351 |
| Density | 0.895g/cm3 |
| Boiling point | 510.5°C at 760 mmHg |
| Flash point | 191.2°C |
| Refractive index | 1.479 |
65416-33-3 tris[(e)-3,7-dimethylocta-2,6-dien-1-ol], triester with boric acid
service@apichina.com