| Product Name | Tris(dimethylamino)borane |
| CAS No. | 4375-83-1 |
| Synonyms | AI3-61066; Boranetriamine, hexamethyl-; N,N',N''-boranetriyltris(N-methylmethanamine) |
| InChI | InChI=1/C6H18BN3/c1-8(2)7(9(3)4)10(5)6/h1-6H3 |
| Molecular Formula | C6H18BN3 |
| Molecular Weight | 143.0382 |
| Density | 0.835g/cm3 |
| Melting point | -16℃ |
| Boiling point | 147.3°C at 760 mmHg |
| Flash point | 42.9°C |
| Refractive index | 1.432 |
| Hazard Symbols |  F:Highly flammable;  Xi:Irritant; |
| Risk Codes | R11:Highly flammable.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
4375-83-1 tris(dimethylamino)borane
service@apichina.com