| Product Name | tris(3-fluorophenyl)phosphine |
| CAS No. | 23039-94-3 |
| Synonyms | Tris(3-fluorophenyl)phosphine; tris(3-fluorophenyl)phosphane; Tri(3-fluorophenyl)phosphine |
| InChI | InChI=1/C18H12F3P/c19-13-4-1-7-16(10-13)22(17-8-2-5-14(20)11-17)18-9-3-6-15(21)12-18/h1-12H |
| Molecular Formula | C18H12F3P |
| Molecular Weight | 316.2569 |
| Boiling point | 371.1°C at 760 mmHg |
| Flash point | 178.2°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
23039-94-3 tris(3-fluorophenyl)phosphine
service@apichina.com