| Product Name | tris(2-methylphenyl)phosphine |
| CAS No. | 6163-58-2 |
| Synonyms | Intermediate Of Eletriptan And Rizatriptan; Phosphine, Tri-O-Tolyl-; Tri-Ortho-Tolylphosphine; Tris(2-Methylphenyl)-Phosphin; Phosphorus Tri-O-Tolyl; Tris(O-Tolyl)Phosphine; Tris(2-Tolyl)Phosphine; Tri-O-Tolyphosphine; Tri-O-Tolylphosphine; Tris(2-Methylphenyl)Phosphane; Tri(O-Tolyl)Phosphine; Tri(2-Methylphenyl)Phosphine |
| InChI | InChI=1/C21H21P/c1-16-10-4-7-13-19(16)22(20-14-8-5-11-17(20)2)21-15-9-6-12-18(21)3/h4-15H,1-3H3 |
| Molecular Formula | C21H21P |
| Molecular Weight | 304.3652 |
| Melting point | 120-122℃ |
| Boiling point | 412.4°C at 760 mmHg |
| Flash point | 214.6°C |
| Hazard Symbols | |
| Risk Codes | R36/37/38:; |
| Safety | S26:; S37/39:; |
6163-58-2 tris(2-methylphenyl)phosphine
service@apichina.com