| Product Name | Tris(2-methylallyl)amine |
| CAS No. | 6321-40-0 |
| Synonyms | 2-methyl-N,N-bis(2-methylprop-2-en-1-yl)prop-2-en-1-amine; 2-methyl-N,N-bis(2-methylprop-2-en-1-yl)prop-2-en-1-aminium |
| InChI | InChI=1/C12H21N/c1-10(2)7-13(8-11(3)4)9-12(5)6/h1,3,5,7-9H2,2,4,6H3/p+1 |
| Molecular Formula | C12H22N |
| Molecular Weight | 180.3092 |
| Boiling point | 194.9°C at 760 mmHg |
| Flash point | 53.3°C |
| Hazard Symbols | |
| Risk Codes | R10:Flammable.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S24/25:Avoid contact with skin and eyes.; |
6321-40-0 tris(2-methylallyl)amine
service@apichina.com