| Product Name | tris[2-mercaptoethyl] orthoborate |
| CAS No. | 15582-80-6 |
| Synonyms | Ethanol, 2-mercapto-, 1,1',1''-triester with boric acid (H3BO3); Tri(2-mercaptoethyl) borate; Ethanol, 2-mercapto-, O,O,O-triester with boric acid (H3BO3); Tris(2-mercaptoethyl) orthoborate; tris(2-sulfanylethyl) borate |
| InChI | InChI=1/C6H15BO3S3/c11-4-1-8-7(9-2-5-12)10-3-6-13/h11-13H,1-6H2 |
| Molecular Formula | C6H15BO3S3 |
| Molecular Weight | 242.1875 |
| Density | 1.149g/cm3 |
| Boiling point | 285.6°C at 760 mmHg |
| Flash point | 126.5°C |
| Refractive index | 1.502 |
15582-80-6 tris[2-mercaptoethyl] orthoborate
service@apichina.com