| Product Name | tris(2-ethylhexanoic) acid, trianhydride with boric acid |
| CAS No. | 51136-86-8 |
| Synonyms | Hexanoic acid, 2-ethyl-, 1,1',1''-trianhydride with boric acid (H3BO3); Boron 2-ethylhexanoate; Tri(2-Ethylhexanoyl)borate; Hexanoic acid, 2-ethyl-, trianhydride with boric acid (H3BO3); Tris(2-ethylhexanoic) acid, trianhydride with boric acid; tris(2-ethylhexanoyl) borate |
| InChI | InChI=1/C24H45BO6/c1-7-13-16-19(10-4)22(26)29-25(30-23(27)20(11-5)17-14-8-2)31-24(28)21(12-6)18-15-9-3/h19-21H,7-18H2,1-6H3 |
| Molecular Formula | C24H45BO6 |
| Molecular Weight | 440.4215 |
| Density | 0.961g/cm3 |
| Boiling point | 480.4°C at 760 mmHg |
| Flash point | 244.3°C |
| Refractive index | 1.444 |
51136-86-8 tris(2-ethylhexanoic) acid, trianhydride with boric acid
service@apichina.com