| Product Name | Tris[2-(diphenylphosphino)ethyl]phosphine |
| CAS No. | 23582-03-8 |
| Synonyms | Tris(2-diphenylphosphinoethyl)phosphine; TETRAPHOS-II; (phosphanetriyltriethane-2,1-diyl)tris(diphenylphosphane) |
| InChI | InChI=1/C42H42P4/c1-7-19-37(20-8-1)44(38-21-9-2-10-22-38)34-31-43(32-35-45(39-23-11-3-12-24-39)40-25-13-4-14-26-40)33-36-46(41-27-15-5-16-28-41)42-29-17-6-18-30-42/h1-30H,31-36H2 |
| Molecular Formula | C42H42P4 |
| Molecular Weight | 670.6779 |
| Melting point | 134-135℃ |
| Boiling point | 740.1°C at 760 mmHg |
| Flash point | 429.4°C |
| Hazard Symbols | |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
23582-03-8 tris[2-(diphenylphosphino)ethyl]phosphine
service@apichina.com