| Product Name | Triphenylcarbenium tetrafluoroborate |
| CAS No. | 341-02-6 |
| Synonyms | Trityl fluoroborate; Tritylium tetrafluoroborate; Trityl tetrafluoroborate; triphenylmethylium tetrafluoroborate |
| InChI | InChI=1/C19H15.BF4/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;2-1(3,4)5/h1-15H;/q+1;-1 |
| Molecular Formula | C19H15BF4 |
| Molecular Weight | 330.127 |
| Melting point | 205-215℃ |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S25:Avoid contact with eyes.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
341-02-6 triphenylcarbenium tetrafluoroborate
service@apichina.com