| Product Name | Triphenylcarbenium pentachlorostannate |
| CAS No. | 15414-98-9 |
| Synonyms | Trityl pentachlorostannate; tin(4+) triphenylmethylium chloride (1:1:5) |
| InChI | InChI=1/C19H15.5ClH.Sn/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;;;;/h1-15H;5*1H;/q+1;;;;;;+4/p-5 |
| Molecular Formula | C19H15Cl5Sn |
| Molecular Weight | 539.2974 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S24/25:Avoid contact with skin and eyes.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; |
15414-98-9 triphenylcarbenium pentachlorostannate
service@apichina.com