| Product Name | Triphenylcarbenium hexafluorophosphate |
| CAS No. | 437-17-2 |
| Synonyms | Trityl hexafluorophosphate; Tritylium hexafluorophosphate; triphenylmethylium hexafluorophosphate |
| InChI | InChI=1/C19H15.F6P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-7(2,3,4,5)6/h1-15H;/q+1;-1 |
| Molecular Weight | 243.3219 |
| Melting point | 150℃ |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R20/21:Harmful by inhalation and in contact with skin.; R34:Causes burns.; |
| Safety | S28:After contact with skin, wash immediately with plenty of ...; |
437-17-2 triphenylcarbenium hexafluorophosphate
service@apichina.com