| Product Name | Triphenylacrylonitrile |
| CAS No. | 6304-33-2 |
| Synonyms | Cyanotriphenylethylene; 2,3,3-triphenylprop-2-enenitrile |
| InChI | InChI=1/C21H15N/c22-16-20(17-10-4-1-5-11-17)21(18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-15H |
| Molecular Formula | C21H15N |
| Molecular Weight | 281.3505 |
| Density | 1.114g/cm3 |
| Boiling point | 403.2°C at 760 mmHg |
| Flash point | 198.9°C |
| Refractive index | 1.63 |
| Risk Codes | R20/22:Harmful by inhalation and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S22:Do not inhale dust.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
6304-33-2 triphenylacrylonitrile
service@apichina.com