| Product Name | Trimethylsulfoniumbromide |
| CAS No. | 3084-53-5 |
| Synonyms | Trimethylsulfonium bromide; Trimethylsulphonium bromide; trimethylsulfonium; Trimethyl-sulfoniubromide; Sulfonium, trimethyl-, bromide |
| InChI | InChI=1/C3H9S.BrH/c1-4(2)3;/h1-3H3;1H/q+1;/p-1 |
| Molecular Formula | C3H9BrS |
| Molecular Weight | 157.0726 |
| Melting point | 203℃ |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
3084-53-5 trimethylsulfoniumbromide
service@apichina.com