| Product Name | Trimethyliodogermane |
| CAS No. | 1066-38-2 |
| Synonyms | Trimethylgermanium iodide; Iodotrimethylgermane; trimethylgermanylium iodide |
| InChI | InChI=1/C3H9Ge.HI/c1-4(2)3;/h1-3H3;1H/q+1;/p-1 |
| Molecular Formula | C3H9GeI |
| Molecular Weight | 244.648 |
| Hazard Symbols |  T:Toxic; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R34:Causes burns.; R61:May cause harm to the unborn child.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; S53:Avoid exposure - obtain special instructions before use.; |
1066-38-2 trimethyliodogermane
service@apichina.com