| Product Name | Trimethyl 1,3,5-benzenetricarboxylate |
| CAS No. | 2672-58-4 |
| Synonyms | Trimethyl benzene-1,3,5-tricarboxylate; Trimethyl Trimesate; 1,3,5-Benzenetricarboxylic acid trimethyl ester; benzene-1,3,5-triyl triacetate; trimethyl cyclohexane-1,3,5-tricarboxylate |
| InChI | InChI=1/C12H18O6/c1-16-10(13)7-4-8(11(14)17-2)6-9(5-7)12(15)18-3/h7-9H,4-6H2,1-3H3 |
| Molecular Formula | C12H18O6 |
| Molecular Weight | 258.2677 |
| Density | 1.177g/cm3 |
| Melting point | 144-147℃ |
| Boiling point | 332.8°C at 760 mmHg |
| Flash point | 144.1°C |
| Refractive index | 1.464 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
2672-58-4 trimethyl 1,3,5-benzenetricarboxylate
service@apichina.com
- Next:12217-46-8 basic orange 33
- Previous:12217-45-7 basic orange 30