| Product Name | trimenthol, triester with boric acid, stereoisomer |
| CAS No. | 62697-74-9 |
| Synonyms | Cyclohexanol, 5-methyl-2-(1-methylethyl)-, 1,1',1''-triester with boric acid (H3BO3), (1R,1'R,1''R,2S,2'S,2''S,5R,5'R,5''R)-rel-; 5-Methyl-2-(1-methylethyl)cyclohexanol, triester with boris acid (H3BO3), stereoisomer; Cyclohexanol, 5-methyl-2-(1-methylethyl)-, triester with boric acid (H3BO3), (1R,1'R,1''R,2S,2'S,2''S,5R,5'R,5''R)-rel-; tris[(1R,2S,5R)-5-methyl-2-(propan-2-yl)cyclohexyl] borate; 5-methyl-2-(propan-2-yl)cyclohexyl dihydrogen borate |
| InChI | InChI=1/C10H21BO3/c1-7(2)9-5-4-8(3)6-10(9)14-11(12)13/h7-10,12-13H,4-6H2,1-3H3 |
| Molecular Formula | C10H21BO3 |
| Molecular Weight | 200.0829 |
| Density | 0.99g/cm3 |
| Boiling point | 294.1°C at 760 mmHg |
| Flash point | 131.7°C |
| Refractive index | 1.454 |
62697-74-9 trimenthol, triester with boric acid, stereoisomer
service@apichina.com