| Product Name | Triisobutylborane |
| CAS No. | 1116-39-8 |
| Synonyms | Borane, tris(2-methylpropyl)-; tris(2-methylpropyl)borane |
| InChI | InChI=1/C12H27B/c1-10(2)7-13(8-11(3)4)9-12(5)6/h10-12H,7-9H2,1-6H3 |
| Molecular Formula | C12H27B |
| Molecular Weight | 182.1538 |
| Density | 0.729g/cm3 |
| Boiling point | 219.9°C at 760 mmHg |
| Flash point | 86.8°C |
| Refractive index | 1.403 |
| Hazard Symbols |  F:Highly flammable;  C:Corrosive; |
| Risk Codes | R11:Highly flammable.; R15:Contact with water liberates highly flammable gases.; R19:May form explosive peroxides.; R34:Causes burns.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S25:Avoid contact with eyes.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; S7/8:Keep container tightly closed and dry.; |
1116-39-8 triisobutylborane
service@apichina.com