| Product Name | Triethylsulphonium tetrafluoroborate |
| CAS No. | 368-40-1 |
| Synonyms | Triethylsulfonium tetrafluoroborate |
| InChI | InChI=1/C6H15S.BF4/c1-4-7(5-2)6-3;2-1(3,4)5/h4-6H2,1-3H3;/q+1;-1 |
| Molecular Formula | C6H15BF4S |
| Molecular Weight | 206.0529 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
368-40-1 triethylsulphonium tetrafluoroborate
service@apichina.com