| Product Name | Triethylsulfonium iodide |
| CAS No. | 1829-92-1 |
| Synonyms | Triethylsulphonium iodide; triethylsulfonium bromide |
| InChI | InChI=1/C6H15S.BrH/c1-4-7(5-2)6-3;/h4-6H2,1-3H3;1H/q+1;/p-1 |
| Molecular Formula | C6H15BrS |
| Molecular Weight | 199.1523 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1829-92-1 triethylsulfonium iodide
service@apichina.com