| Product Name | Triethylgermanium |
| CAS No. | 1188-14-3 |
| Synonyms | Germane, triethyl-; triethylgermane; triethylgermanyl |
| InChI | InChI=1/C6H15Ge/c1-4-7(5-2)6-3/h4-6H2,1-3H3 |
| Molecular Formula | C6H15Ge |
| Molecular Weight | 159.8233 |
| Hazard Symbols |  F:Highly flammable;  Xn:Harmful; |
| Risk Codes | R11:Highly flammable.; R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S36/37:Wear suitable protective clothing and gloves.; |
1188-14-3 triethylgermanium
service@apichina.com