| Product Name | Triethylenemelamine |
| CAS No. | 51-18-3 |
| Synonyms | Tretamine; 2,4,6-tri(aziridin-1-yl)-1,3,5-triazine; 2,4,6-Tris(1-aziridinyl)-s-triazine; TEM; 2,4,6-tris(aziridin-1-yl)-1,3,5-triazine |
| InChI | InChI=1/C9H12N6/c1-2-13(1)7-10-8(14-3-4-14)12-9(11-7)15-5-6-15/h1-6H2 |
| Molecular Formula | C9H12N6 |
| Molecular Weight | 204.2318 |
| Density | 1.617g/cm3 |
| Melting point | 160℃ |
| Boiling point | 430.2°C at 760 mmHg |
| Flash point | 214°C |
| Refractive index | 1.789 |
| Hazard Symbols |  T+:Very toxic; |
| Risk Codes | R28:Very toxic if swallowed.; R40:Possible risks of irreversible effects.; |
| Safety | S24/25:Avoid contact with skin and eyes.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
51-18-3 triethylenemelamine
service@apichina.com